About 3,4-dichloro-5,6-dimethyl-1H-pyridin-2-one
3,4-dichloro-5,6-dimethyl-1H-pyridin-2-one (PubChem CID 4691511) has the molecular formula C7H7Cl2NO
and a molecular weight of 192.04 g/mol. Its IUPAC name is 3,4-dichloro-5,6-dimethyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 3,4-dichloro-5,6-dimethyl-1H-pyridin-2-one |
| PubChem CID | 4691511 |
| Molecular Formula | C7H7Cl2NO |
| Molecular Weight | 192.04 g/mol |
| Exact Mass | 190.99 |
| IUPAC Name | 3,4-dichloro-5,6-dimethyl-1H-pyridin-2-one |
| SMILES | Cc1[nH]c(=O)c(Cl)c(Cl)c1C |
| InChI | InChI=1S/C7H7Cl2NO/c1-3-4(2)10-7(11)6(9)5(3)8/h1-2H3,(H,10,11) |
| InChIKey | RKHXJSXKRSXBOE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.04 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-dichloro-5,6-dimethyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dichloro-5,6-dimethyl-1H-pyridin-2-one?
The IUPAC name of 3,4-dichloro-5,6-dimethyl-1H-pyridin-2-one (CID 4691511) is 3,4-dichloro-5,6-dimethyl-1H-pyridin-2-one.
What is the SMILES notation for 3,4-dichloro-5,6-dimethyl-1H-pyridin-2-one?
The canonical SMILES for 3,4-dichloro-5,6-dimethyl-1H-pyridin-2-one is Cc1[nH]c(=O)c(Cl)c(Cl)c1C.
What is the InChIKey of 3,4-dichloro-5,6-dimethyl-1H-pyridin-2-one?
The InChIKey is RKHXJSXKRSXBOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Cl2NO/c1-3-4(2)10-7(11)6(9)5(3)8/h1-2H3,(H,10,11).
What are the key properties of 3,4-dichloro-5,6-dimethyl-1H-pyridin-2-one?
3,4-dichloro-5,6-dimethyl-1H-pyridin-2-one has a molecular weight of 192.04 g/mol, XLogP of 2.30, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dichloro-5,6-dimethyl-1H-pyridin-2-one is sourced from PubChem (CID 4691511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).