C23H38N2O6 — CID 46915241
(2R,3R)-3-[(4R,5R)-5-[(1E,3E)-5,5-dimethylhexa-1,3-dienyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-methoxy-N-[(3S)-2-oxoazepan-3-yl]propanamide (PubChem CID 46915241) has the molecular formula C23H38N2O6 and a molecular weight of 438.57 g/mol. Its IUPAC name is (2R,3R)-3-[(4R,5R)-5-[(1E,3E)-5,5-dimethylhexa-1,3-dienyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-methoxy-N-[(3S)-2-oxoazepan-3-yl]propanamide.
| Compound Name | (2R,3R)-3-[(4R,5R)-5-[(1E,3E)-5,5-dimethylhexa-1,3-dienyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-methoxy-N-[(3S)-2-oxoazepan-3-yl]propanamide |
|---|---|
| PubChem CID | 46915241 |
| Molecular Formula | C23H38N2O6 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | (2R,3R)-3-[(4R,5R)-5-[(1E,3E)-5,5-dimethylhexa-1,3-dienyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-methoxy-N-[(3S)-2-oxoazepan-3-yl]propanamide |
| SMILES | CO[C@@H](C(=O)N[C@H]1CCCCNC1=O)[C@H](O)[C@H]1OC(C)(C)O[C@@H]1/C=C/C=C/C(C)(C)C |
| InChI | InChI=1S/C23H38N2O6/c1-22(2,3)13-9-7-12-16-18(31-23(4,5)30-16)17(26)19(29-6)21(28)25-15-11-8-10-14-24-20(15)27/h7,9,12-13,15-19,26H,8,10-11,14H2,1-6H3,(H,24,27)(H,25,28)/b12-7+,13-9+/t15-,16+,17+,18-,19+/m0/s1 |
| InChIKey | PLCOKLYZHVOTKS-RUBQPWRKSA-N |
| XLogP | 1.83 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|