About 6-amino-3,9-dimethyl-7H-purine-2,8-dione;hydrochloride
6-amino-3,9-dimethyl-7H-purine-2,8-dione;hydrochloride (PubChem CID 46915371) has the molecular formula C7H10ClN5O2
and a molecular weight of 231.64 g/mol. Its IUPAC name is 6-amino-3,9-dimethyl-7H-purine-2,8-dione;hydrochloride.
Molecular Properties
| Compound Name | 6-amino-3,9-dimethyl-7H-purine-2,8-dione;hydrochloride |
| PubChem CID | 46915371 |
| Molecular Formula | C7H10ClN5O2 |
| Molecular Weight | 231.64 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 6-amino-3,9-dimethyl-7H-purine-2,8-dione;hydrochloride |
| SMILES | Cl.Cn1c(=O)nc(N)c2[nH]c(=O)n(C)c21 |
| InChI | InChI=1S/C7H9N5O2.ClH/c1-11-5-3(9-6(11)13)4(8)10-7(14)12(5)2;/h1-2H3,(H,9,13)(H2,8,10,14);1H |
| InChIKey | LTTKKYLRTIZURJ-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.64 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-amino-3,9-dimethyl-7H-purine-2,8-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3,9-dimethyl-7H-purine-2,8-dione;hydrochloride?
The IUPAC name of 6-amino-3,9-dimethyl-7H-purine-2,8-dione;hydrochloride (CID 46915371) is 6-amino-3,9-dimethyl-7H-purine-2,8-dione;hydrochloride.
What is the SMILES notation for 6-amino-3,9-dimethyl-7H-purine-2,8-dione;hydrochloride?
The canonical SMILES for 6-amino-3,9-dimethyl-7H-purine-2,8-dione;hydrochloride is Cl.Cn1c(=O)nc(N)c2[nH]c(=O)n(C)c21.
What is the InChIKey of 6-amino-3,9-dimethyl-7H-purine-2,8-dione;hydrochloride?
The InChIKey is LTTKKYLRTIZURJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5O2.ClH/c1-11-5-3(9-6(11)13)4(8)10-7(14)12(5)2;/h1-2H3,(H,9,13)(H2,8,10,14);1H.
What are the key properties of 6-amino-3,9-dimethyl-7H-purine-2,8-dione;hydrochloride?
6-amino-3,9-dimethyl-7H-purine-2,8-dione;hydrochloride has a molecular weight of 231.64 g/mol, XLogP of -1.04, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3,9-dimethyl-7H-purine-2,8-dione;hydrochloride is sourced from PubChem (CID 46915371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).