About 6-amino-3,9-dimethyl-7H-purine-2,8-dione
6-amino-3,9-dimethyl-7H-purine-2,8-dione (PubChem CID 46915372) has the molecular formula C7H9N5O2
and a molecular weight of 195.18 g/mol. Its IUPAC name is 6-amino-3,9-dimethyl-7H-purine-2,8-dione.
Molecular Properties
| Compound Name | 6-amino-3,9-dimethyl-7H-purine-2,8-dione |
| PubChem CID | 46915372 |
| Molecular Formula | C7H9N5O2 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 6-amino-3,9-dimethyl-7H-purine-2,8-dione |
| SMILES | Cn1c(=O)nc(N)c2[nH]c(=O)n(C)c21 |
| InChI | InChI=1S/C7H9N5O2/c1-11-5-3(9-6(11)13)4(8)10-7(14)12(5)2/h1-2H3,(H,9,13)(H2,8,10,14) |
| InChIKey | PGIDADRKLVPTLG-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-amino-3,9-dimethyl-7H-purine-2,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3,9-dimethyl-7H-purine-2,8-dione?
The IUPAC name of 6-amino-3,9-dimethyl-7H-purine-2,8-dione (CID 46915372) is 6-amino-3,9-dimethyl-7H-purine-2,8-dione.
What is the SMILES notation for 6-amino-3,9-dimethyl-7H-purine-2,8-dione?
The canonical SMILES for 6-amino-3,9-dimethyl-7H-purine-2,8-dione is Cn1c(=O)nc(N)c2[nH]c(=O)n(C)c21.
What is the InChIKey of 6-amino-3,9-dimethyl-7H-purine-2,8-dione?
The InChIKey is PGIDADRKLVPTLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5O2/c1-11-5-3(9-6(11)13)4(8)10-7(14)12(5)2/h1-2H3,(H,9,13)(H2,8,10,14).
What are the key properties of 6-amino-3,9-dimethyl-7H-purine-2,8-dione?
6-amino-3,9-dimethyl-7H-purine-2,8-dione has a molecular weight of 195.18 g/mol, XLogP of -1.46, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3,9-dimethyl-7H-purine-2,8-dione is sourced from PubChem (CID 46915372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).