C17H26O3 — CID 46915469
[(1R,3aS,5S,8aR)-8a-methyl-6-methylidene-3-oxo-1-propan-2-yl-2,3a,4,5,7,8-hexahydro-1H-azulen-5-yl] acetate (PubChem CID 46915469) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is [(1R,3aS,5S,8aR)-8a-methyl-6-methylidene-3-oxo-1-propan-2-yl-2,3a,4,5,7,8-hexahydro-1H-azulen-5-yl] acetate.
| Compound Name | [(1R,3aS,5S,8aR)-8a-methyl-6-methylidene-3-oxo-1-propan-2-yl-2,3a,4,5,7,8-hexahydro-1H-azulen-5-yl] acetate |
|---|---|
| PubChem CID | 46915469 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | [(1R,3aS,5S,8aR)-8a-methyl-6-methylidene-3-oxo-1-propan-2-yl-2,3a,4,5,7,8-hexahydro-1H-azulen-5-yl] acetate |
| SMILES | C=C1CC[C@@]2(C)[C@H](C[C@@H]1OC(C)=O)C(=O)C[C@@H]2C(C)C |
| InChI | InChI=1S/C17H26O3/c1-10(2)13-8-15(19)14-9-16(20-12(4)18)11(3)6-7-17(13,14)5/h10,13-14,16H,3,6-9H2,1-2,4-5H3/t13-,14-,16+,17-/m1/s1 |
| InChIKey | QSECIWAVIULHQK-TXCZRRACSA-N |
| XLogP | 3.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|