C26H40O6 — CID 46915611
tert-butyl 5-[(1R,6R,8aR)-6,8a-dimethyl-5-oxo-1-propan-2-ylspiro[1,2,7,8-tetrahydroazulene-3,2'-1,3-dioxolane]-6-yl]-3-oxopentanoate (PubChem CID 46915611) has the molecular formula C26H40O6 and a molecular weight of 448.60 g/mol. Its IUPAC name is tert-butyl 5-[(1R,6R,8aR)-6,8a-dimethyl-5-oxo-1-propan-2-ylspiro[1,2,7,8-tetrahydroazulene-3,2'-1,3-dioxolane]-6-yl]-3-oxopentanoate.
| Compound Name | tert-butyl 5-[(1R,6R,8aR)-6,8a-dimethyl-5-oxo-1-propan-2-ylspiro[1,2,7,8-tetrahydroazulene-3,2'-1,3-dioxolane]-6-yl]-3-oxopentanoate |
|---|---|
| PubChem CID | 46915611 |
| Molecular Formula | C26H40O6 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | tert-butyl 5-[(1R,6R,8aR)-6,8a-dimethyl-5-oxo-1-propan-2-ylspiro[1,2,7,8-tetrahydroazulene-3,2'-1,3-dioxolane]-6-yl]-3-oxopentanoate |
| SMILES | CC(C)[C@H]1CC2(OCCO2)C2=CC(=O)[C@@](C)(CCC(=O)CC(=O)OC(C)(C)C)CC[C@@]21C |
| InChI | InChI=1S/C26H40O6/c1-17(2)19-16-26(30-12-13-31-26)20-15-21(28)24(6,10-11-25(19,20)7)9-8-18(27)14-22(29)32-23(3,4)5/h15,17,19H,8-14,16H2,1-7H3/t19-,24+,25-/m1/s1 |
| InChIKey | FRQQPCZFKZVICF-BTZRARBUSA-N |
| XLogP | 4.79 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|