C26H38O5 — CID 46915612
tert-butyl (3'R,3'aR,5'aR)-3'a,5'a-dimethyl-8'-oxo-3'-propan-2-ylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,7-hexahydrobenzo[f]azulene]-9'-carboxylate (PubChem CID 46915612) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is tert-butyl (3'R,3'aR,5'aR)-3'a,5'a-dimethyl-8'-oxo-3'-propan-2-ylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,7-hexahydrobenzo[f]azulene]-9'-carboxylate.
| Compound Name | tert-butyl (3'R,3'aR,5'aR)-3'a,5'a-dimethyl-8'-oxo-3'-propan-2-ylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,7-hexahydrobenzo[f]azulene]-9'-carboxylate |
|---|---|
| PubChem CID | 46915612 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | tert-butyl (3'R,3'aR,5'aR)-3'a,5'a-dimethyl-8'-oxo-3'-propan-2-ylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,7-hexahydrobenzo[f]azulene]-9'-carboxylate |
| SMILES | CC(C)[C@H]1CC2(OCCO2)C2=CC3=C(C(=O)OC(C)(C)C)C(=O)CC[C@@]3(C)CC[C@@]21C |
| InChI | InChI=1S/C26H38O5/c1-16(2)18-15-26(29-12-13-30-26)20-14-17-21(22(28)31-23(3,4)5)19(27)8-9-24(17,6)10-11-25(18,20)7/h14,16,18H,8-13,15H2,1-7H3/t18-,24+,25-/m1/s1 |
| InChIKey | ATBFTINUMUOMQF-AYCKEJKLSA-N |
| XLogP | 5.14 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|