C37H50O6S2 — CID 46915627
[(2S,3S,6S,8R,9S)-8-[(2R)-2,3-bis(phenylmethoxy)propyl]-3-methoxy-9-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]-[2-[(2S)-but-3-en-2-yl]-1,3-dithian-2-yl]methanone (PubChem CID 46915627) has the molecular formula C37H50O6S2 and a molecular weight of 654.94 g/mol. Its IUPAC name is [(2S,3S,6S,8R,9S)-8-[(2R)-2,3-bis(phenylmethoxy)propyl]-3-methoxy-9-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]-[2-[(2S)-but-3-en-2-yl]-1,3-dithian-2-yl]methanone.
| Compound Name | [(2S,3S,6S,8R,9S)-8-[(2R)-2,3-bis(phenylmethoxy)propyl]-3-methoxy-9-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]-[2-[(2S)-but-3-en-2-yl]-1,3-dithian-2-yl]methanone |
|---|---|
| PubChem CID | 46915627 |
| Molecular Formula | C37H50O6S2 |
| Molecular Weight | 654.94 g/mol |
| Exact Mass | 654.30 |
| IUPAC Name | [(2S,3S,6S,8R,9S)-8-[(2R)-2,3-bis(phenylmethoxy)propyl]-3-methoxy-9-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]-[2-[(2S)-but-3-en-2-yl]-1,3-dithian-2-yl]methanone |
| SMILES | C=C[C@H](C)C1(C(=O)[C@H]2O[C@]3(CC[C@@H]2OC)CC[C@H](C)[C@@H](C[C@H](COCc2ccccc2)OCc2ccccc2)O3)SCCCS1 |
| InChI | InChI=1S/C37H50O6S2/c1-5-28(3)37(44-21-12-22-45-37)35(38)34-32(39-4)18-20-36(43-34)19-17-27(2)33(42-36)23-31(41-25-30-15-10-7-11-16-30)26-40-24-29-13-8-6-9-14-29/h5-11,13-16,27-28,31-34H,1,12,17-26H2,2-4H3/t27-,28-,31+,32-,33+,34-,36-/m0/s1 |
| InChIKey | RDUUEVFZAWGWBM-UCPAYVFPSA-N |
| XLogP | 7.84 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.94 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|