C39H61NO4 — CID 46915699
ethyl (2S,3S)-1-[bis(3,5-ditert-butyl-4-methoxyphenyl)methyl]-3-propylaziridine-2-carboxylate (PubChem CID 46915699) has the molecular formula C39H61NO4 and a molecular weight of 607.92 g/mol. Its IUPAC name is ethyl (2S,3S)-1-[bis(3,5-ditert-butyl-4-methoxyphenyl)methyl]-3-propylaziridine-2-carboxylate.
| Compound Name | ethyl (2S,3S)-1-[bis(3,5-ditert-butyl-4-methoxyphenyl)methyl]-3-propylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 46915699 |
| Molecular Formula | C39H61NO4 |
| Molecular Weight | 607.92 g/mol |
| Exact Mass | 607.46 |
| IUPAC Name | ethyl (2S,3S)-1-[bis(3,5-ditert-butyl-4-methoxyphenyl)methyl]-3-propylaziridine-2-carboxylate |
| SMILES | CCC[C@H]1[C@@H](C(=O)OCC)N1C(c1cc(C(C)(C)C)c(OC)c(C(C)(C)C)c1)c1cc(C(C)(C)C)c(OC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C39H61NO4/c1-17-19-30-32(35(41)44-18-2)40(30)31(24-20-26(36(3,4)5)33(42-15)27(21-24)37(6,7)8)25-22-28(38(9,10)11)34(43-16)29(23-25)39(12,13)14/h20-23,30-32H,17-19H2,1-16H3/t30-,32-,40?/m0/s1 |
| InChIKey | ASSBOMOOUJHISQ-YEOMRDIASA-N |
| XLogP | 9.40 |
| TPSA | 47.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.92 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|