C31H42N4OS+2 — CID 46916358
3-[[7-methoxy-1-methyl-4-[(E)-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl]quinolin-1-ium-2-yl]-propylamino]propyl-trimethylazanium (PubChem CID 46916358) has the molecular formula C31H42N4OS+2 and a molecular weight of 518.77 g/mol. Its IUPAC name is 3-[[7-methoxy-1-methyl-4-[(E)-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl]quinolin-1-ium-2-yl]-propylamino]propyl-trimethylazanium.
| Compound Name | 3-[[7-methoxy-1-methyl-4-[(E)-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl]quinolin-1-ium-2-yl]-propylamino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 46916358 |
| Molecular Formula | C31H42N4OS+2 |
| Molecular Weight | 518.77 g/mol |
| Exact Mass | 518.31 |
| IUPAC Name | 3-[[7-methoxy-1-methyl-4-[(E)-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl]quinolin-1-ium-2-yl]-propylamino]propyl-trimethylazanium |
| SMILES | CCCN(CCC[N+](C)(C)C)c1cc(/C=C2/Sc3cccc4c3N2CCC4)c2ccc(OC)cc2[n+]1C |
| InChI | InChI=1S/C31H42N4OS/c1-7-16-33(17-10-19-35(3,4)5)29-20-24(26-15-14-25(36-6)22-27(26)32(29)2)21-30-34-18-9-12-23-11-8-13-28(37-30)31(23)34/h8,11,13-15,20-22H,7,9-10,12,16-19H2,1-6H3/q+2 |
| InChIKey | GCERGLPWQDEWPF-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 19.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.77 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|