C20H25FN6S — CID 46916423
2-(4-fluorophenyl)-7-(4-pentylpiperazin-1-yl)-[1,3]thiazolo[5,4-d]pyrimidin-5-amine (PubChem CID 46916423) has the molecular formula C20H25FN6S and a molecular weight of 400.53 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-7-(4-pentylpiperazin-1-yl)-[1,3]thiazolo[5,4-d]pyrimidin-5-amine.
| Compound Name | 2-(4-fluorophenyl)-7-(4-pentylpiperazin-1-yl)-[1,3]thiazolo[5,4-d]pyrimidin-5-amine |
|---|---|
| PubChem CID | 46916423 |
| Molecular Formula | C20H25FN6S |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 2-(4-fluorophenyl)-7-(4-pentylpiperazin-1-yl)-[1,3]thiazolo[5,4-d]pyrimidin-5-amine |
| SMILES | CCCCCN1CCN(c2nc(N)nc3sc(-c4ccc(F)cc4)nc23)CC1 |
| InChI | InChI=1S/C20H25FN6S/c1-2-3-4-9-26-10-12-27(13-11-26)17-16-19(25-20(22)24-17)28-18(23-16)14-5-7-15(21)8-6-14/h5-8H,2-4,9-13H2,1H3,(H2,22,24,25) |
| InChIKey | VMNXWHGGIWMLBQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|