C39H37F3N4O2S — CID 46917002
N'-benzyl-N,N-dimethyl-N'-[1-phenyl-4-[(E)-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl]quinolin-1-ium-2-yl]ethane-1,2-diamine;2,2,2-trifluoroacetate (PubChem CID 46917002) has the molecular formula C39H37F3N4O2S and a molecular weight of 682.81 g/mol. Its IUPAC name is N'-benzyl-N,N-dimethyl-N'-[1-phenyl-4-[(E)-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl]quinolin-1-ium-2-yl]ethane-1,2-diamine;2,2,2-trifluoroacetate.
| Compound Name | N'-benzyl-N,N-dimethyl-N'-[1-phenyl-4-[(E)-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl]quinolin-1-ium-2-yl]ethane-1,2-diamine;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 46917002 |
| Molecular Formula | C39H37F3N4O2S |
| Molecular Weight | 682.81 g/mol |
| Exact Mass | 682.26 |
| IUPAC Name | N'-benzyl-N,N-dimethyl-N'-[1-phenyl-4-[(E)-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl]quinolin-1-ium-2-yl]ethane-1,2-diamine;2,2,2-trifluoroacetate |
| SMILES | CN(C)CCN(Cc1ccccc1)c1cc(/C=C2/Sc3cccc4c3N2CCC4)c2ccccc2[n+]1-c1ccccc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C37H37N4S.C2HF3O2/c1-38(2)23-24-39(27-28-13-5-3-6-14-28)35-25-30(26-36-40-22-12-16-29-15-11-21-34(42-36)37(29)40)32-19-9-10-20-33(32)41(35)31-17-7-4-8-18-31;3-2(4,5)1(6)7/h3-11,13-15,17-21,25-26H,12,16,22-24,27H2,1-2H3;(H,6,7)/q+1;/p-1 |
| InChIKey | RIQNTLIFCMCDOI-UHFFFAOYSA-M |
| XLogP | 6.84 |
| TPSA | 53.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.81 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|