C37H41F3N4O2S — CID 46917004
N'-butyl-N,N-dimethyl-N'-[1-phenyl-4-[(E)-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl]quinolin-1-ium-2-yl]propane-1,3-diamine;2,2,2-trifluoroacetate (PubChem CID 46917004) has the molecular formula C37H41F3N4O2S and a molecular weight of 662.82 g/mol. Its IUPAC name is N'-butyl-N,N-dimethyl-N'-[1-phenyl-4-[(E)-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl]quinolin-1-ium-2-yl]propane-1,3-diamine;2,2,2-trifluoroacetate.
| Compound Name | N'-butyl-N,N-dimethyl-N'-[1-phenyl-4-[(E)-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl]quinolin-1-ium-2-yl]propane-1,3-diamine;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 46917004 |
| Molecular Formula | C37H41F3N4O2S |
| Molecular Weight | 662.82 g/mol |
| Exact Mass | 662.29 |
| IUPAC Name | N'-butyl-N,N-dimethyl-N'-[1-phenyl-4-[(E)-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl]quinolin-1-ium-2-yl]propane-1,3-diamine;2,2,2-trifluoroacetate |
| SMILES | CCCCN(CCCN(C)C)c1cc(/C=C2/Sc3cccc4c3N2CCC4)c2ccccc2[n+]1-c1ccccc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C35H41N4S.C2HF3O2/c1-4-5-22-37(23-13-21-36(2)3)33-25-28(26-34-38-24-12-15-27-14-11-20-32(40-34)35(27)38)30-18-9-10-19-31(30)39(33)29-16-7-6-8-17-29;3-2(4,5)1(6)7/h6-11,14,16-20,25-26H,4-5,12-13,15,21-24H2,1-3H3;(H,6,7)/q+1;/p-1 |
| InChIKey | BSHIVMAWXSXXGM-UHFFFAOYSA-M |
| XLogP | 6.83 |
| TPSA | 53.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.82 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|