C24H22F2N4O5S — CID 46917315
N-[4-[4-(cyclopropylmethoxy)-3,5-difluorophenyl]-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxofuro[2,3-d]pyrimidin-5-yl)acetamide (PubChem CID 46917315) has the molecular formula C24H22F2N4O5S and a molecular weight of 516.53 g/mol. Its IUPAC name is N-[4-[4-(cyclopropylmethoxy)-3,5-difluorophenyl]-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxofuro[2,3-d]pyrimidin-5-yl)acetamide.
| Compound Name | N-[4-[4-(cyclopropylmethoxy)-3,5-difluorophenyl]-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxofuro[2,3-d]pyrimidin-5-yl)acetamide |
|---|---|
| PubChem CID | 46917315 |
| Molecular Formula | C24H22F2N4O5S |
| Molecular Weight | 516.53 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | N-[4-[4-(cyclopropylmethoxy)-3,5-difluorophenyl]-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxofuro[2,3-d]pyrimidin-5-yl)acetamide |
| SMILES | Cc1oc2c(c1CC(=O)Nc1nc(-c3cc(F)c(OCC4CC4)c(F)c3)cs1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C24H22F2N4O5S/c1-11-14(19-21(32)29(2)24(33)30(3)22(19)35-11)8-18(31)28-23-27-17(10-36-23)13-6-15(25)20(16(26)7-13)34-9-12-4-5-12/h6-7,10,12H,4-5,8-9H2,1-3H3,(H,27,28,31) |
| InChIKey | FSBOPXIXDZXMOU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |