C22H18F4N4O4S — CID 46917316
N-[4-[4-fluoro-3-(trifluoromethyl)phenyl]-5-methyl-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxofuro[2,3-d]pyrimidin-5-yl)acetamide (PubChem CID 46917316) has the molecular formula C22H18F4N4O4S and a molecular weight of 510.47 g/mol. Its IUPAC name is N-[4-[4-fluoro-3-(trifluoromethyl)phenyl]-5-methyl-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxofuro[2,3-d]pyrimidin-5-yl)acetamide.
| Compound Name | N-[4-[4-fluoro-3-(trifluoromethyl)phenyl]-5-methyl-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxofuro[2,3-d]pyrimidin-5-yl)acetamide |
|---|---|
| PubChem CID | 46917316 |
| Molecular Formula | C22H18F4N4O4S |
| Molecular Weight | 510.47 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | N-[4-[4-fluoro-3-(trifluoromethyl)phenyl]-5-methyl-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxofuro[2,3-d]pyrimidin-5-yl)acetamide |
| SMILES | Cc1oc2c(c1CC(=O)Nc1nc(-c3ccc(F)c(C(F)(F)F)c3)c(C)s1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C22H18F4N4O4S/c1-9-12(16-18(32)29(3)21(33)30(4)19(16)34-9)8-15(31)27-20-28-17(10(2)35-20)11-5-6-14(23)13(7-11)22(24,25)26/h5-7H,8H2,1-4H3,(H,27,28,31) |
| InChIKey | GQTHGPVTSGDJBM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |