About [4-(3-cycloheptyl-7-methyl-2-oxo-1H-indol-3-yl)phenyl] 2-(dimethylamino)acetate
[4-(3-cycloheptyl-7-methyl-2-oxo-1H-indol-3-yl)phenyl] 2-(dimethylamino)acetate (PubChem CID 46917343) has the molecular formula C26H32N2O3
and a molecular weight of 420.55 g/mol. Its IUPAC name is [4-(3-cycloheptyl-7-methyl-2-oxo-1H-indol-3-yl)phenyl] 2-(dimethylamino)acetate.
Molecular Properties
| Compound Name | [4-(3-cycloheptyl-7-methyl-2-oxo-1H-indol-3-yl)phenyl] 2-(dimethylamino)acetate |
| PubChem CID | 46917343 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | [4-(3-cycloheptyl-7-methyl-2-oxo-1H-indol-3-yl)phenyl] 2-(dimethylamino)acetate |
| SMILES | Cc1cccc2c1NC(=O)C2(c1ccc(OC(=O)CN(C)C)cc1)C1CCCCCC1 |
| InChI | InChI=1S/C26H32N2O3/c1-18-9-8-12-22-24(18)27-25(30)26(22,19-10-6-4-5-7-11-19)20-13-15-21(16-14-20)31-23(29)17-28(2)3/h8-9,12-16,19H,4-7,10-11,17H2,1-3H3,(H,27,30) |
| InChIKey | OPLXKQRFJSCAMI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(3-cycloheptyl-7-methyl-2-oxo-1H-indol-3-yl)phenyl] 2-(dimethylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-cycloheptyl-7-methyl-2-oxo-1H-indol-3-yl)phenyl] 2-(dimethylamino)acetate?
The IUPAC name of [4-(3-cycloheptyl-7-methyl-2-oxo-1H-indol-3-yl)phenyl] 2-(dimethylamino)acetate (CID 46917343) is [4-(3-cycloheptyl-7-methyl-2-oxo-1H-indol-3-yl)phenyl] 2-(dimethylamino)acetate.
What is the SMILES notation for [4-(3-cycloheptyl-7-methyl-2-oxo-1H-indol-3-yl)phenyl] 2-(dimethylamino)acetate?
The canonical SMILES for [4-(3-cycloheptyl-7-methyl-2-oxo-1H-indol-3-yl)phenyl] 2-(dimethylamino)acetate is Cc1cccc2c1NC(=O)C2(c1ccc(OC(=O)CN(C)C)cc1)C1CCCCCC1.
What is the InChIKey of [4-(3-cycloheptyl-7-methyl-2-oxo-1H-indol-3-yl)phenyl] 2-(dimethylamino)acetate?
The InChIKey is OPLXKQRFJSCAMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32N2O3/c1-18-9-8-12-22-24(18)27-25(30)26(22,19-10-6-4-5-7-11-19)20-13-15-21(16-14-20)31-23(29)17-28(2)3/h8-9,12-16,19H,4-7,10-11,17H2,1-3H3,(H,27,30).
What are the key properties of [4-(3-cycloheptyl-7-methyl-2-oxo-1H-indol-3-yl)phenyl] 2-(dimethylamino)acetate?
[4-(3-cycloheptyl-7-methyl-2-oxo-1H-indol-3-yl)phenyl] 2-(dimethylamino)acetate has a molecular weight of 420.55 g/mol, XLogP of 4.67, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-cycloheptyl-7-methyl-2-oxo-1H-indol-3-yl)phenyl] 2-(dimethylamino)acetate is sourced from PubChem (CID 46917343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).