C43H45FN2O4 — CID 46917353
5-(4-fluorophenyl)-N,4-diphenyl-1-[2-[(2R,4R)-4-phenylmethoxy-6-prop-2-enoxyoxan-2-yl]ethyl]-2-propan-2-ylpyrrole-3-carboxamide (PubChem CID 46917353) has the molecular formula C43H45FN2O4 and a molecular weight of 672.84 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N,4-diphenyl-1-[2-[(2R,4R)-4-phenylmethoxy-6-prop-2-enoxyoxan-2-yl]ethyl]-2-propan-2-ylpyrrole-3-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N,4-diphenyl-1-[2-[(2R,4R)-4-phenylmethoxy-6-prop-2-enoxyoxan-2-yl]ethyl]-2-propan-2-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 46917353 |
| Molecular Formula | C43H45FN2O4 |
| Molecular Weight | 672.84 g/mol |
| Exact Mass | 672.34 |
| IUPAC Name | 5-(4-fluorophenyl)-N,4-diphenyl-1-[2-[(2R,4R)-4-phenylmethoxy-6-prop-2-enoxyoxan-2-yl]ethyl]-2-propan-2-ylpyrrole-3-carboxamide |
| SMILES | C=CCOC1C[C@H](OCc2ccccc2)C[C@@H](CCn2c(-c3ccc(F)cc3)c(-c3ccccc3)c(C(=O)Nc3ccccc3)c2C(C)C)O1 |
| InChI | InChI=1S/C43H45FN2O4/c1-4-26-48-38-28-37(49-29-31-14-8-5-9-15-31)27-36(50-38)24-25-46-41(30(2)3)40(43(47)45-35-18-12-7-13-19-35)39(32-16-10-6-11-17-32)42(46)33-20-22-34(44)23-21-33/h4-23,30,36-38H,1,24-29H2,2-3H3,(H,45,47)/t36-,37-,38?/m1/s1 |
| InChIKey | RFBDJMVSIWLFFC-QCUZFKLTSA-N |
| XLogP | 10.02 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.84 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|