C27H43N3O2Si2 — CID 46917474
2-[N-(cyclopropylmethyl)-3,5-bis(triethylsilyl)anilino]pyrimidine-5-carboxylic acid (PubChem CID 46917474) has the molecular formula C27H43N3O2Si2 and a molecular weight of 497.83 g/mol. Its IUPAC name is 2-[N-(cyclopropylmethyl)-3,5-bis(triethylsilyl)anilino]pyrimidine-5-carboxylic acid.
| Compound Name | 2-[N-(cyclopropylmethyl)-3,5-bis(triethylsilyl)anilino]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 46917474 |
| Molecular Formula | C27H43N3O2Si2 |
| Molecular Weight | 497.83 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | 2-[N-(cyclopropylmethyl)-3,5-bis(triethylsilyl)anilino]pyrimidine-5-carboxylic acid |
| SMILES | CC[Si](CC)(CC)c1cc(N(CC2CC2)c2ncc(C(=O)O)cn2)cc([Si](CC)(CC)CC)c1 |
| InChI | InChI=1S/C27H43N3O2Si2/c1-7-33(8-2,9-3)24-15-23(16-25(17-24)34(10-4,11-5)12-6)30(20-21-13-14-21)27-28-18-22(19-29-27)26(31)32/h15-19,21H,7-14,20H2,1-6H3,(H,31,32) |
| InChIKey | RNOVBZDJVCOCCQ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.83 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|