C21H16ClF3N4O5S — CID 46917681
N-[4-[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]-1,3-thiazol-2-yl]-2-(1,3-dimethyl-2,4-dioxofuro[2,3-d]pyrimidin-5-yl)acetamide (PubChem CID 46917681) has the molecular formula C21H16ClF3N4O5S and a molecular weight of 528.90 g/mol. Its IUPAC name is N-[4-[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]-1,3-thiazol-2-yl]-2-(1,3-dimethyl-2,4-dioxofuro[2,3-d]pyrimidin-5-yl)acetamide.
| Compound Name | N-[4-[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]-1,3-thiazol-2-yl]-2-(1,3-dimethyl-2,4-dioxofuro[2,3-d]pyrimidin-5-yl)acetamide |
|---|---|
| PubChem CID | 46917681 |
| Molecular Formula | C21H16ClF3N4O5S |
| Molecular Weight | 528.90 g/mol |
| Exact Mass | 528.05 |
| IUPAC Name | N-[4-[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]-1,3-thiazol-2-yl]-2-(1,3-dimethyl-2,4-dioxofuro[2,3-d]pyrimidin-5-yl)acetamide |
| SMILES | Cn1c(=O)c2c(CC(=O)Nc3nc(-c4ccc(OCC(F)(F)F)c(Cl)c4)cs3)coc2n(C)c1=O |
| InChI | InChI=1S/C21H16ClF3N4O5S/c1-28-17(31)16-11(7-33-18(16)29(2)20(28)32)6-15(30)27-19-26-13(8-35-19)10-3-4-14(12(22)5-10)34-9-21(23,24)25/h3-5,7-8H,6,9H2,1-2H3,(H,26,27,30) |
| InChIKey | KDULHEBQVMXFLR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.90 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |