C8H12FN3O — CID 46917700
5-(3-fluoropiperidin-3-yl)-3-methyl-1,2,4-oxadiazole (PubChem CID 46917700) has the molecular formula C8H12FN3O and a molecular weight of 185.20 g/mol. Its IUPAC name is 5-(3-fluoropiperidin-3-yl)-3-methyl-1,2,4-oxadiazole.
| Compound Name | 5-(3-fluoropiperidin-3-yl)-3-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 46917700 |
| Molecular Formula | C8H12FN3O |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 5-(3-fluoropiperidin-3-yl)-3-methyl-1,2,4-oxadiazole |
| SMILES | Cc1noc(C2(F)CCCNC2)n1 |
| InChI | InChI=1S/C8H12FN3O/c1-6-11-7(13-12-6)8(9)3-2-4-10-5-8/h10H,2-5H2,1H3 |
| InChIKey | FMWZOLRSJUNGCR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |