C25H24FN7O — CID 46918126
N-[2-(dimethylamino)ethyl]-4-[12-fluoro-4-(1-methylpyrazol-4-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl]benzamide (PubChem CID 46918126) has the molecular formula C25H24FN7O and a molecular weight of 457.51 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-[12-fluoro-4-(1-methylpyrazol-4-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl]benzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-[12-fluoro-4-(1-methylpyrazol-4-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl]benzamide |
|---|---|
| PubChem CID | 46918126 |
| Molecular Formula | C25H24FN7O |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-[12-fluoro-4-(1-methylpyrazol-4-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl]benzamide |
| SMILES | CN(C)CCNC(=O)c1ccc(-c2c(F)cnc3[nH]c4cnc(-c5cnn(C)c5)cc4c23)cc1 |
| InChI | InChI=1S/C25H24FN7O/c1-32(2)9-8-27-25(34)16-6-4-15(5-7-16)22-19(26)12-29-24-23(22)18-10-20(28-13-21(18)31-24)17-11-30-33(3)14-17/h4-7,10-14H,8-9H2,1-3H3,(H,27,34)(H,29,31) |
| InChIKey | GARQOMAPKJOGPP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |