About 4-[(2,4-diaminopteridin-6-yl)methylamino]benzenesulfonic acid
4-[(2,4-diaminopteridin-6-yl)methylamino]benzenesulfonic acid (PubChem CID 46918149) has the molecular formula C13H13N7O3S
and a molecular weight of 347.36 g/mol. Its IUPAC name is 4-[(2,4-diaminopteridin-6-yl)methylamino]benzenesulfonic acid.
Molecular Properties
| Compound Name | 4-[(2,4-diaminopteridin-6-yl)methylamino]benzenesulfonic acid |
| PubChem CID | 46918149 |
| Molecular Formula | C13H13N7O3S |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 4-[(2,4-diaminopteridin-6-yl)methylamino]benzenesulfonic acid |
| SMILES | Nc1nc(N)c2nc(CNc3ccc(S(=O)(=O)O)cc3)cnc2n1 |
| InChI | InChI=1S/C13H13N7O3S/c14-11-10-12(20-13(15)19-11)17-6-8(18-10)5-16-7-1-3-9(4-2-7)24(21,22)23/h1-4,6,16H,5H2,(H,21,22,23)(H4,14,15,17,19,20) |
| InChIKey | ZOAIIIMQIPTDLO-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 170.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,4-diaminopteridin-6-yl)methylamino]benzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,4-diaminopteridin-6-yl)methylamino]benzenesulfonic acid?
The IUPAC name of 4-[(2,4-diaminopteridin-6-yl)methylamino]benzenesulfonic acid (CID 46918149) is 4-[(2,4-diaminopteridin-6-yl)methylamino]benzenesulfonic acid.
What is the SMILES notation for 4-[(2,4-diaminopteridin-6-yl)methylamino]benzenesulfonic acid?
The canonical SMILES for 4-[(2,4-diaminopteridin-6-yl)methylamino]benzenesulfonic acid is Nc1nc(N)c2nc(CNc3ccc(S(=O)(=O)O)cc3)cnc2n1.
What is the InChIKey of 4-[(2,4-diaminopteridin-6-yl)methylamino]benzenesulfonic acid?
The InChIKey is ZOAIIIMQIPTDLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N7O3S/c14-11-10-12(20-13(15)19-11)17-6-8(18-10)5-16-7-1-3-9(4-2-7)24(21,22)23/h1-4,6,16H,5H2,(H,21,22,23)(H4,14,15,17,19,20).
What are the key properties of 4-[(2,4-diaminopteridin-6-yl)methylamino]benzenesulfonic acid?
4-[(2,4-diaminopteridin-6-yl)methylamino]benzenesulfonic acid has a molecular weight of 347.36 g/mol, XLogP of 0.44, 4 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,4-diaminopteridin-6-yl)methylamino]benzenesulfonic acid is sourced from PubChem (CID 46918149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).