C20H27N5 — CID 46918448
2-[bis(3-tert-butylpyrazol-1-yl)methyl]pyridine (PubChem CID 46918448) has the molecular formula C20H27N5 and a molecular weight of 337.47 g/mol. Its IUPAC name is 2-[bis(3-tert-butylpyrazol-1-yl)methyl]pyridine.
| Compound Name | 2-[bis(3-tert-butylpyrazol-1-yl)methyl]pyridine |
|---|---|
| PubChem CID | 46918448 |
| Molecular Formula | C20H27N5 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 2-[bis(3-tert-butylpyrazol-1-yl)methyl]pyridine |
| SMILES | CC(C)(C)c1ccn(C(c2ccccn2)n2ccc(C(C)(C)C)n2)n1 |
| InChI | InChI=1S/C20H27N5/c1-19(2,3)16-10-13-24(22-16)18(15-9-7-8-12-21-15)25-14-11-17(23-25)20(4,5)6/h7-14,18H,1-6H3 |
| InChIKey | PCACBGUSUCPDPR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |