About 3-chloro-1,2-dimethoxy-4-nitro-5-[(Z)-2-prop-2-enoxyethenyl]benzene
3-chloro-1,2-dimethoxy-4-nitro-5-[(Z)-2-prop-2-enoxyethenyl]benzene (PubChem CID 46918499) has the molecular formula C13H14ClNO5
and a molecular weight of 299.71 g/mol. Its IUPAC name is 3-chloro-1,2-dimethoxy-4-nitro-5-[(Z)-2-prop-2-enoxyethenyl]benzene.
Molecular Properties
| Compound Name | 3-chloro-1,2-dimethoxy-4-nitro-5-[(Z)-2-prop-2-enoxyethenyl]benzene |
| PubChem CID | 46918499 |
| Molecular Formula | C13H14ClNO5 |
| Molecular Weight | 299.71 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 3-chloro-1,2-dimethoxy-4-nitro-5-[(Z)-2-prop-2-enoxyethenyl]benzene |
| SMILES | C=CCO/C=C\c1cc(OC)c(OC)c(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14ClNO5/c1-4-6-20-7-5-9-8-10(18-2)13(19-3)11(14)12(9)15(16)17/h4-5,7-8H,1,6H2,2-3H3/b7-5- |
| InChIKey | GWIJWWBVFIDCED-ALCCZGGFSA-N |
| XLogP | 3.44 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.71 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-1,2-dimethoxy-4-nitro-5-[(Z)-2-prop-2-enoxyethenyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-1,2-dimethoxy-4-nitro-5-[(Z)-2-prop-2-enoxyethenyl]benzene?
The IUPAC name of 3-chloro-1,2-dimethoxy-4-nitro-5-[(Z)-2-prop-2-enoxyethenyl]benzene (CID 46918499) is 3-chloro-1,2-dimethoxy-4-nitro-5-[(Z)-2-prop-2-enoxyethenyl]benzene.
What is the SMILES notation for 3-chloro-1,2-dimethoxy-4-nitro-5-[(Z)-2-prop-2-enoxyethenyl]benzene?
The canonical SMILES for 3-chloro-1,2-dimethoxy-4-nitro-5-[(Z)-2-prop-2-enoxyethenyl]benzene is C=CCO/C=C\c1cc(OC)c(OC)c(Cl)c1[N+](=O)[O-].
What is the InChIKey of 3-chloro-1,2-dimethoxy-4-nitro-5-[(Z)-2-prop-2-enoxyethenyl]benzene?
The InChIKey is GWIJWWBVFIDCED-ALCCZGGFSA-N. The full InChI is InChI=1S/C13H14ClNO5/c1-4-6-20-7-5-9-8-10(18-2)13(19-3)11(14)12(9)15(16)17/h4-5,7-8H,1,6H2,2-3H3/b7-5-.
What are the key properties of 3-chloro-1,2-dimethoxy-4-nitro-5-[(Z)-2-prop-2-enoxyethenyl]benzene?
3-chloro-1,2-dimethoxy-4-nitro-5-[(Z)-2-prop-2-enoxyethenyl]benzene has a molecular weight of 299.71 g/mol, XLogP of 3.44, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-1,2-dimethoxy-4-nitro-5-[(Z)-2-prop-2-enoxyethenyl]benzene is sourced from PubChem (CID 46918499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).