C20H36N4O6 — CID 46919223
methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-6-(2,2-dimethylpropanoylamino)hexanoyl]amino]propanoate (PubChem CID 46919223) has the molecular formula C20H36N4O6 and a molecular weight of 428.53 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-6-(2,2-dimethylpropanoylamino)hexanoyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-6-(2,2-dimethylpropanoylamino)hexanoyl]amino]propanoate |
|---|---|
| PubChem CID | 46919223 |
| Molecular Formula | C20H36N4O6 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-6-(2,2-dimethylpropanoylamino)hexanoyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)[C@H](CCCCNC(=O)C(C)(C)C)NC(=O)[C@H](C)NC(C)=O |
| InChI | InChI=1S/C20H36N4O6/c1-12(22-14(3)25)16(26)24-15(17(27)23-13(2)18(28)30-7)10-8-9-11-21-19(29)20(4,5)6/h12-13,15H,8-11H2,1-7H3,(H,21,29)(H,22,25)(H,23,27)(H,24,26)/t12-,13-,15-/m0/s1 |
| InChIKey | BWVFADPGAHLHBC-YDHLFZDLSA-N |
| XLogP | 0.01 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|