C16H13NO4S — CID 46919228
N-(4-methoxyphenyl)-1,1-dioxo-1-benzothiophene-6-carboxamide (PubChem CID 46919228) has the molecular formula C16H13NO4S and a molecular weight of 315.35 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-1,1-dioxo-1-benzothiophene-6-carboxamide.
| Compound Name | N-(4-methoxyphenyl)-1,1-dioxo-1-benzothiophene-6-carboxamide |
|---|---|
| PubChem CID | 46919228 |
| Molecular Formula | C16H13NO4S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | N-(4-methoxyphenyl)-1,1-dioxo-1-benzothiophene-6-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc3c(c2)S(=O)(=O)C=C3)cc1 |
| InChI | InChI=1S/C16H13NO4S/c1-21-14-6-4-13(5-7-14)17-16(18)12-3-2-11-8-9-22(19,20)15(11)10-12/h2-10H,1H3,(H,17,18) |
| InChIKey | IVRAUHQFIWQYAC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |