C27H52O4Si2 — CID 46919355
(1S,2R,4S,7R,8R,10R)-7,10-bis[[tert-butyl(dimethyl)silyl]oxy]-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undec-5-en-4-ol (PubChem CID 46919355) has the molecular formula C27H52O4Si2 and a molecular weight of 496.88 g/mol. Its IUPAC name is (1S,2R,4S,7R,8R,10R)-7,10-bis[[tert-butyl(dimethyl)silyl]oxy]-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undec-5-en-4-ol.
| Compound Name | (1S,2R,4S,7R,8R,10R)-7,10-bis[[tert-butyl(dimethyl)silyl]oxy]-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undec-5-en-4-ol |
|---|---|
| PubChem CID | 46919355 |
| Molecular Formula | C27H52O4Si2 |
| Molecular Weight | 496.88 g/mol |
| Exact Mass | 496.34 |
| IUPAC Name | (1S,2R,4S,7R,8R,10R)-7,10-bis[[tert-butyl(dimethyl)silyl]oxy]-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undec-5-en-4-ol |
| SMILES | CC1=C2[C@@H](C[C@@H]1O)[C@]1(C)O[C@@](C(C)C)(C[C@H]1O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H52O4Si2/c1-17(2)27-16-21(29-32(11,12)24(4,5)6)26(10,31-27)19-15-20(28)18(3)22(19)23(27)30-33(13,14)25(7,8)9/h17,19-21,23,28H,15-16H2,1-14H3/t19-,20+,21-,23-,26+,27-/m1/s1 |
| InChIKey | COHAWXQREKGGJC-RLFKVNLLSA-N |
| XLogP | 7.05 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.88 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|