About 2-ethyladamantan-2-amine
2-ethyladamantan-2-amine (PubChem CID 4691950) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is 2-ethyladamantan-2-amine.
Molecular Properties
| Compound Name | 2-ethyladamantan-2-amine |
| PubChem CID | 4691950 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 2-ethyladamantan-2-amine |
| SMILES | CCC1(N)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C12H21N/c1-2-12(13)10-4-8-3-9(6-10)7-11(12)5-8/h8-11H,2-7,13H2,1H3 |
| InChIKey | KKYGOXFNQZFIQT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyladamantan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyladamantan-2-amine?
The IUPAC name of 2-ethyladamantan-2-amine (CID 4691950) is 2-ethyladamantan-2-amine.
What is the SMILES notation for 2-ethyladamantan-2-amine?
The canonical SMILES for 2-ethyladamantan-2-amine is CCC1(N)C2CC3CC(C2)CC1C3.
What is the InChIKey of 2-ethyladamantan-2-amine?
The InChIKey is KKYGOXFNQZFIQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N/c1-2-12(13)10-4-8-3-9(6-10)7-11(12)5-8/h8-11H,2-7,13H2,1H3.
What are the key properties of 2-ethyladamantan-2-amine?
2-ethyladamantan-2-amine has a molecular weight of 179.31 g/mol, XLogP of 2.55, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyladamantan-2-amine is sourced from PubChem (CID 4691950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).