About CID 46919524
CID 46919524 (PubChem CID 46919524) has the molecular formula C32H27ClFeNOP+2
and a molecular weight of 563.85 g/mol.
Molecular Properties
| Compound Name | CID 46919524 |
| PubChem CID | 46919524 |
| Molecular Formula | C32H27ClFeNOP+2 |
| Molecular Weight | 563.85 g/mol |
| Exact Mass | 563.09 |
| IUPAC Name | — |
| SMILES | C[C@@H](/N=C1\OCc2cc(Cl)ccc21)[C]1[CH][CH][CH][C]1P(c1ccccc1)c1ccccc1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C27H22ClNOP.C5H5.Fe/c1-19(29-27-25-16-15-21(28)17-20(25)18-30-27)24-13-8-14-26(24)31(22-9-4-2-5-10-22)23-11-6-3-7-12-23;1-2-4-5-3-1;/h2-17,19H,18H2,1H3;1-5H;/q;;+2/b29-27-;;/t19-;;/m1../s1 |
| InChIKey | DVFZZMKIZNQPRR-VMVHPGHHSA-N |
| XLogP | 6.89 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 563.85 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 46919524 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 46919524?
The IUPAC name of CID 46919524 (CID 46919524) is not available.
What is the SMILES notation for CID 46919524?
The canonical SMILES for CID 46919524 is C[C@@H](/N=C1\OCc2cc(Cl)ccc21)[C]1[CH][CH][CH][C]1P(c1ccccc1)c1ccccc1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 46919524?
The InChIKey is DVFZZMKIZNQPRR-VMVHPGHHSA-N. The full InChI is InChI=1S/C27H22ClNOP.C5H5.Fe/c1-19(29-27-25-16-15-21(28)17-20(25)18-30-27)24-13-8-14-26(24)31(22-9-4-2-5-10-22)23-11-6-3-7-12-23;1-2-4-5-3-1;/h2-17,19H,18H2,1H3;1-5H;/q;;+2/b29-27-;;/t19-;;/m1../s1.
What are the key properties of CID 46919524?
CID 46919524 has a molecular weight of 563.85 g/mol, XLogP of 6.89, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 46919524 is sourced from PubChem (CID 46919524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).