C15H18O5 — CID 46919542
(1S,7S,10Z)-7-methyl-2,6-dioxabicyclo[10.3.1]hexadeca-10,12(16)-diene-3,5,13-trione (PubChem CID 46919542) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is (1S,7S,10Z)-7-methyl-2,6-dioxabicyclo[10.3.1]hexadeca-10,12(16)-diene-3,5,13-trione.
| Compound Name | (1S,7S,10Z)-7-methyl-2,6-dioxabicyclo[10.3.1]hexadeca-10,12(16)-diene-3,5,13-trione |
|---|---|
| PubChem CID | 46919542 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (1S,7S,10Z)-7-methyl-2,6-dioxabicyclo[10.3.1]hexadeca-10,12(16)-diene-3,5,13-trione |
| SMILES | C[C@H]1CC/C=C\C2=C[C@H](CCC2=O)OC(=O)CC(=O)O1 |
| InChI | InChI=1S/C15H18O5/c1-10-4-2-3-5-11-8-12(6-7-13(11)16)20-15(18)9-14(17)19-10/h3,5,8,10,12H,2,4,6-7,9H2,1H3/b5-3-/t10-,12-/m0/s1 |
| InChIKey | PCKXJTKETPCSTI-CVEGFPIKSA-N |
| XLogP | 1.86 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|