C15H20O7 — CID 46919545
(1S,2R,6S,9S,12S,16S)-1,2-dihydroxy-6-methyl-7,11-dioxatricyclo[7.6.1.012,16]hexadecane-8,10,15-trione (PubChem CID 46919545) has the molecular formula C15H20O7 and a molecular weight of 312.32 g/mol. Its IUPAC name is (1S,2R,6S,9S,12S,16S)-1,2-dihydroxy-6-methyl-7,11-dioxatricyclo[7.6.1.012,16]hexadecane-8,10,15-trione.
| Compound Name | (1S,2R,6S,9S,12S,16S)-1,2-dihydroxy-6-methyl-7,11-dioxatricyclo[7.6.1.012,16]hexadecane-8,10,15-trione |
|---|---|
| PubChem CID | 46919545 |
| Molecular Formula | C15H20O7 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (1S,2R,6S,9S,12S,16S)-1,2-dihydroxy-6-methyl-7,11-dioxatricyclo[7.6.1.012,16]hexadecane-8,10,15-trione |
| SMILES | C[C@H]1CCC[C@@H](O)[C@]2(O)C(=O)CC[C@@H]3OC(=O)[C@H](C(=O)O1)[C@@H]32 |
| InChI | InChI=1S/C15H20O7/c1-7-3-2-4-9(16)15(20)10(17)6-5-8-12(15)11(13(18)21-7)14(19)22-8/h7-9,11-12,16,20H,2-6H2,1H3/t7-,8-,9+,11-,12+,15-/m0/s1 |
| InChIKey | VHMHRSWUXHGGCK-WXMLGECQSA-N |
| XLogP | -0.29 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|