C22H32O8 — CID 46919629
diethyl 2-[(1R,2R,3R,4S)-4-ethoxycarbonyl-2-formyl-3-[(Z)-hex-3-enyl]-5-oxocyclopentyl]propanedioate (PubChem CID 46919629) has the molecular formula C22H32O8 and a molecular weight of 424.49 g/mol. Its IUPAC name is diethyl 2-[(1R,2R,3R,4S)-4-ethoxycarbonyl-2-formyl-3-[(Z)-hex-3-enyl]-5-oxocyclopentyl]propanedioate.
| Compound Name | diethyl 2-[(1R,2R,3R,4S)-4-ethoxycarbonyl-2-formyl-3-[(Z)-hex-3-enyl]-5-oxocyclopentyl]propanedioate |
|---|---|
| PubChem CID | 46919629 |
| Molecular Formula | C22H32O8 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | diethyl 2-[(1R,2R,3R,4S)-4-ethoxycarbonyl-2-formyl-3-[(Z)-hex-3-enyl]-5-oxocyclopentyl]propanedioate |
| SMILES | CC/C=C\CC[C@H]1[C@H](C(=O)OCC)C(=O)[C@@H](C(C(=O)OCC)C(=O)OCC)[C@@H]1C=O |
| InChI | InChI=1S/C22H32O8/c1-5-9-10-11-12-14-15(13-23)16(19(24)17(14)20(25)28-6-2)18(21(26)29-7-3)22(27)30-8-4/h9-10,13-18H,5-8,11-12H2,1-4H3/b10-9-/t14-,15-,16-,17+/m1/s1 |
| InChIKey | MHYHXZNWSPNLDT-VOZWJMJSSA-N |
| XLogP | 2.28 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|