C18H15Cl2N3O3 — CID 46920320
N-(3,5-dichlorophenyl)-3-(2,4-dimethoxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 46920320) has the molecular formula C18H15Cl2N3O3 and a molecular weight of 392.24 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-3-(2,4-dimethoxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-(3,5-dichlorophenyl)-3-(2,4-dimethoxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 46920320 |
| Molecular Formula | C18H15Cl2N3O3 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | N-(3,5-dichlorophenyl)-3-(2,4-dimethoxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)Nc3cc(Cl)cc(Cl)c3)[nH]n2)c(OC)c1 |
| InChI | InChI=1S/C18H15Cl2N3O3/c1-25-13-3-4-14(17(8-13)26-2)15-9-16(23-22-15)18(24)21-12-6-10(19)5-11(20)7-12/h3-9H,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | FDMKLVXSMOTBFI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |