C21H21ClN4O — CID 46920414
[3-(2-chlorophenyl)-1H-pyrazol-5-yl]-[4-(4-methylphenyl)piperazin-1-yl]methanone (PubChem CID 46920414) has the molecular formula C21H21ClN4O and a molecular weight of 380.88 g/mol. Its IUPAC name is [3-(2-chlorophenyl)-1H-pyrazol-5-yl]-[4-(4-methylphenyl)piperazin-1-yl]methanone.
| Compound Name | [3-(2-chlorophenyl)-1H-pyrazol-5-yl]-[4-(4-methylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 46920414 |
| Molecular Formula | C21H21ClN4O |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | [3-(2-chlorophenyl)-1H-pyrazol-5-yl]-[4-(4-methylphenyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccc(N2CCN(C(=O)c3cc(-c4ccccc4Cl)n[nH]3)CC2)cc1 |
| InChI | InChI=1S/C21H21ClN4O/c1-15-6-8-16(9-7-15)25-10-12-26(13-11-25)21(27)20-14-19(23-24-20)17-4-2-3-5-18(17)22/h2-9,14H,10-13H2,1H3,(H,23,24) |
| InChIKey | CGUREEFQRCCGRN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|