C21H23N3O7S — CID 4692362
(7-azido-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl) 4-methylbenzenesulfonate (PubChem CID 4692362) has the molecular formula C21H23N3O7S and a molecular weight of 461.50 g/mol. Its IUPAC name is (7-azido-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl) 4-methylbenzenesulfonate.
| Compound Name | (7-azido-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 4692362 |
| Molecular Formula | C21H23N3O7S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | (7-azido-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl) 4-methylbenzenesulfonate |
| SMILES | COC1OC2COC(c3ccccc3)OC2C(OS(=O)(=O)c2ccc(C)cc2)C1N=[N+]=[N-] |
| InChI | InChI=1S/C21H23N3O7S/c1-13-8-10-15(11-9-13)32(25,26)31-19-17(23-24-22)21(27-2)29-16-12-28-20(30-18(16)19)14-6-4-3-5-7-14/h3-11,16-21H,12H2,1-2H3 |
| InChIKey | BGFLXDJWUSEZOP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 129.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|