About 2-(1,3-benzothiazol-2-yl)-5-(2-methoxyethyl)-4-methyl-3-oxopyrazolo[4,3-c]pyridin-6-olate
2-(1,3-benzothiazol-2-yl)-5-(2-methoxyethyl)-4-methyl-3-oxopyrazolo[4,3-c]pyridin-6-olate (PubChem CID 46924854) has the molecular formula C17H15N4O3S-
and a molecular weight of 355.40 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-5-(2-methoxyethyl)-4-methyl-3-oxopyrazolo[4,3-c]pyridin-6-olate.
Molecular Properties
| Compound Name | 2-(1,3-benzothiazol-2-yl)-5-(2-methoxyethyl)-4-methyl-3-oxopyrazolo[4,3-c]pyridin-6-olate |
| PubChem CID | 46924854 |
| Molecular Formula | C17H15N4O3S- |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-5-(2-methoxyethyl)-4-methyl-3-oxopyrazolo[4,3-c]pyridin-6-olate |
| SMILES | COCCn1c([O-])cc2nn(-c3nc4ccccc4s3)c(=O)c-2c1C |
| InChI | InChI=1S/C17H16N4O3S/c1-10-15-12(9-14(22)20(10)7-8-24-2)19-21(16(15)23)17-18-11-5-3-4-6-13(11)25-17/h3-6,9,22H,7-8H2,1-2H3/p-1 |
| InChIKey | DZZMPHSMSHYKKR-UHFFFAOYSA-M |
| XLogP | 1.78 |
| TPSA | 85.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-(1,3-benzothiazol-2-yl)-5-(2-methoxyethyl)-4-methyl-3-oxopyrazolo[4,3-c]pyridin-6-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzothiazol-2-yl)-5-(2-methoxyethyl)-4-methyl-3-oxopyrazolo[4,3-c]pyridin-6-olate?
The IUPAC name of 2-(1,3-benzothiazol-2-yl)-5-(2-methoxyethyl)-4-methyl-3-oxopyrazolo[4,3-c]pyridin-6-olate (CID 46924854) is 2-(1,3-benzothiazol-2-yl)-5-(2-methoxyethyl)-4-methyl-3-oxopyrazolo[4,3-c]pyridin-6-olate.
What is the SMILES notation for 2-(1,3-benzothiazol-2-yl)-5-(2-methoxyethyl)-4-methyl-3-oxopyrazolo[4,3-c]pyridin-6-olate?
The canonical SMILES for 2-(1,3-benzothiazol-2-yl)-5-(2-methoxyethyl)-4-methyl-3-oxopyrazolo[4,3-c]pyridin-6-olate is COCCn1c([O-])cc2nn(-c3nc4ccccc4s3)c(=O)c-2c1C.
What is the InChIKey of 2-(1,3-benzothiazol-2-yl)-5-(2-methoxyethyl)-4-methyl-3-oxopyrazolo[4,3-c]pyridin-6-olate?
The InChIKey is DZZMPHSMSHYKKR-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H16N4O3S/c1-10-15-12(9-14(22)20(10)7-8-24-2)19-21(16(15)23)17-18-11-5-3-4-6-13(11)25-17/h3-6,9,22H,7-8H2,1-2H3/p-1.
What are the key properties of 2-(1,3-benzothiazol-2-yl)-5-(2-methoxyethyl)-4-methyl-3-oxopyrazolo[4,3-c]pyridin-6-olate?
2-(1,3-benzothiazol-2-yl)-5-(2-methoxyethyl)-4-methyl-3-oxopyrazolo[4,3-c]pyridin-6-olate has a molecular weight of 355.40 g/mol, XLogP of 1.78, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzothiazol-2-yl)-5-(2-methoxyethyl)-4-methyl-3-oxopyrazolo[4,3-c]pyridin-6-olate is sourced from PubChem (CID 46924854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).