About 2-methoxy-1,9-dimethyl-7H-purine-6,8-dione
2-methoxy-1,9-dimethyl-7H-purine-6,8-dione (PubChem CID 46926249) has the molecular formula C8H10N4O3
and a molecular weight of 210.19 g/mol. Its IUPAC name is 2-methoxy-1,9-dimethyl-7H-purine-6,8-dione.
Molecular Properties
| Compound Name | 2-methoxy-1,9-dimethyl-7H-purine-6,8-dione |
| PubChem CID | 46926249 |
| Molecular Formula | C8H10N4O3 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 2-methoxy-1,9-dimethyl-7H-purine-6,8-dione |
| SMILES | COc1nc2c([nH]c(=O)n2C)c(=O)n1C |
| InChI | InChI=1S/C8H10N4O3/c1-11-5-4(9-7(11)14)6(13)12(2)8(10-5)15-3/h1-3H3,(H,9,14) |
| InChIKey | IDVFNSHOEYLXJD-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methoxy-1,9-dimethyl-7H-purine-6,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-1,9-dimethyl-7H-purine-6,8-dione?
The IUPAC name of 2-methoxy-1,9-dimethyl-7H-purine-6,8-dione (CID 46926249) is 2-methoxy-1,9-dimethyl-7H-purine-6,8-dione.
What is the SMILES notation for 2-methoxy-1,9-dimethyl-7H-purine-6,8-dione?
The canonical SMILES for 2-methoxy-1,9-dimethyl-7H-purine-6,8-dione is COc1nc2c([nH]c(=O)n2C)c(=O)n1C.
What is the InChIKey of 2-methoxy-1,9-dimethyl-7H-purine-6,8-dione?
The InChIKey is IDVFNSHOEYLXJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O3/c1-11-5-4(9-7(11)14)6(13)12(2)8(10-5)15-3/h1-3H3,(H,9,14).
What are the key properties of 2-methoxy-1,9-dimethyl-7H-purine-6,8-dione?
2-methoxy-1,9-dimethyl-7H-purine-6,8-dione has a molecular weight of 210.19 g/mol, XLogP of -1.03, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-1,9-dimethyl-7H-purine-6,8-dione is sourced from PubChem (CID 46926249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).