About [(2R)-2,3-dihydroxypropyl] octanoate
[(2R)-2,3-dihydroxypropyl] octanoate (PubChem CID 46926551) has the molecular formula C11H22O4
and a molecular weight of 218.29 g/mol. Its IUPAC name is [(2R)-2,3-dihydroxypropyl] octanoate.
Molecular Properties
| Compound Name | [(2R)-2,3-dihydroxypropyl] octanoate |
| PubChem CID | 46926551 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | [(2R)-2,3-dihydroxypropyl] octanoate |
| SMILES | CCCCCCCC(=O)OC[C@H](O)CO |
| InChI | InChI=1S/C11H22O4/c1-2-3-4-5-6-7-11(14)15-9-10(13)8-12/h10,12-13H,2-9H2,1H3/t10-/m1/s1 |
| InChIKey | GHBFNMLVSPCDGN-SNVBAGLBSA-N |
| XLogP | 1.24 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-2,3-dihydroxypropyl] octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2,3-dihydroxypropyl] octanoate?
The IUPAC name of [(2R)-2,3-dihydroxypropyl] octanoate (CID 46926551) is [(2R)-2,3-dihydroxypropyl] octanoate.
What is the SMILES notation for [(2R)-2,3-dihydroxypropyl] octanoate?
The canonical SMILES for [(2R)-2,3-dihydroxypropyl] octanoate is CCCCCCCC(=O)OC[C@H](O)CO.
What is the InChIKey of [(2R)-2,3-dihydroxypropyl] octanoate?
The InChIKey is GHBFNMLVSPCDGN-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H22O4/c1-2-3-4-5-6-7-11(14)15-9-10(13)8-12/h10,12-13H,2-9H2,1H3/t10-/m1/s1.
What are the key properties of [(2R)-2,3-dihydroxypropyl] octanoate?
[(2R)-2,3-dihydroxypropyl] octanoate has a molecular weight of 218.29 g/mol, XLogP of 1.24, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2,3-dihydroxypropyl] octanoate is sourced from PubChem (CID 46926551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).