C23H31NO12 — CID 46926585
methyl (2R,3R,4S)-3-acetamido-4-acetyloxy-5-prop-2-enyl-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 46926585) has the molecular formula C23H31NO12 and a molecular weight of 513.50 g/mol. Its IUPAC name is methyl (2R,3R,4S)-3-acetamido-4-acetyloxy-5-prop-2-enyl-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2R,3R,4S)-3-acetamido-4-acetyloxy-5-prop-2-enyl-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 46926585 |
| Molecular Formula | C23H31NO12 |
| Molecular Weight | 513.50 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | methyl (2R,3R,4S)-3-acetamido-4-acetyloxy-5-prop-2-enyl-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | C=CCC1=C(C(=O)OC)O[C@@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)[C@H](NC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H31NO12/c1-8-9-16-19(34-14(5)28)18(24-11(2)25)22(36-20(16)23(30)31-7)21(35-15(6)29)17(33-13(4)27)10-32-12(3)26/h8,17-19,21-22H,1,9-10H2,2-7H3,(H,24,25)/t17-,18-,19+,21-,22-/m1/s1 |
| InChIKey | LGTCMHUKFUTMPY-PXIKZMAHSA-N |
| XLogP | 0.25 |
| TPSA | 169.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.50 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|