C25H34N8O — CID 46926738
2-N-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-methoxyphenyl]-6-N-cyclohexyl-7H-purine-2,6-diamine (PubChem CID 46926738) has the molecular formula C25H34N8O and a molecular weight of 462.60 g/mol. Its IUPAC name is 2-N-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-methoxyphenyl]-6-N-cyclohexyl-7H-purine-2,6-diamine.
| Compound Name | 2-N-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-methoxyphenyl]-6-N-cyclohexyl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 46926738 |
| Molecular Formula | C25H34N8O |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | 2-N-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-methoxyphenyl]-6-N-cyclohexyl-7H-purine-2,6-diamine |
| SMILES | COc1cc(N2CCN3CCCC3C2)ccc1Nc1nc(NC2CCCCC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C25H34N8O/c1-34-21-14-18(33-13-12-32-11-5-8-19(32)15-33)9-10-20(21)29-25-30-23-22(26-16-27-23)24(31-25)28-17-6-3-2-4-7-17/h9-10,14,16-17,19H,2-8,11-13,15H2,1H3,(H3,26,27,28,29,30,31) |
| InChIKey | GLGWOJKFHJXQQT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 94.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |