C24H32N8O2 — CID 46926739
2-N-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-methoxyphenyl]-6-N-(oxan-4-yl)-7H-purine-2,6-diamine (PubChem CID 46926739) has the molecular formula C24H32N8O2 and a molecular weight of 464.57 g/mol. Its IUPAC name is 2-N-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-methoxyphenyl]-6-N-(oxan-4-yl)-7H-purine-2,6-diamine.
| Compound Name | 2-N-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-methoxyphenyl]-6-N-(oxan-4-yl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 46926739 |
| Molecular Formula | C24H32N8O2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | 2-N-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-methoxyphenyl]-6-N-(oxan-4-yl)-7H-purine-2,6-diamine |
| SMILES | COc1cc(N2CCN3CCCC3C2)ccc1Nc1nc(NC2CCOCC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C24H32N8O2/c1-33-20-13-17(32-10-9-31-8-2-3-18(31)14-32)4-5-19(20)28-24-29-22-21(25-15-26-22)23(30-24)27-16-6-11-34-12-7-16/h4-5,13,15-16,18H,2-3,6-12,14H2,1H3,(H3,25,26,27,28,29,30) |
| InChIKey | DWLUHAFLGFIVCO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 103.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |