C25H19ClF4N2O5 — CID 46926752
4-[3-chloro-4-[(2R,3R)-4,4,4-trifluoro-3-hydroxy-3-(1-methyl-2-oxopyrido[2,3-b][1,4]oxazin-7-yl)butan-2-yl]phenyl]-2-fluorobenzoic acid (PubChem CID 46926752) has the molecular formula C25H19ClF4N2O5 and a molecular weight of 538.88 g/mol. Its IUPAC name is 4-[3-chloro-4-[(2R,3R)-4,4,4-trifluoro-3-hydroxy-3-(1-methyl-2-oxopyrido[2,3-b][1,4]oxazin-7-yl)butan-2-yl]phenyl]-2-fluorobenzoic acid.
| Compound Name | 4-[3-chloro-4-[(2R,3R)-4,4,4-trifluoro-3-hydroxy-3-(1-methyl-2-oxopyrido[2,3-b][1,4]oxazin-7-yl)butan-2-yl]phenyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 46926752 |
| Molecular Formula | C25H19ClF4N2O5 |
| Molecular Weight | 538.88 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | 4-[3-chloro-4-[(2R,3R)-4,4,4-trifluoro-3-hydroxy-3-(1-methyl-2-oxopyrido[2,3-b][1,4]oxazin-7-yl)butan-2-yl]phenyl]-2-fluorobenzoic acid |
| SMILES | C[C@H](c1ccc(-c2ccc(C(=O)O)c(F)c2)cc1Cl)[C@@](O)(c1cnc2c(c1)N(C)C(=O)CO2)C(F)(F)F |
| InChI | InChI=1S/C25H19ClF4N2O5/c1-12(16-5-3-13(7-18(16)26)14-4-6-17(23(34)35)19(27)8-14)24(36,25(28,29)30)15-9-20-22(31-10-15)37-11-21(33)32(20)2/h3-10,12,36H,11H2,1-2H3,(H,34,35)/t12-,24-/m1/s1 |
| InChIKey | TUYJZFHSBBVOEZ-OIRASMEMSA-N |
| XLogP | 5.15 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.88 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |