About CID 46927170
CID 46927170 (PubChem CID 46927170) has the molecular formula C27H26ClN3O
and a molecular weight of 443.98 g/mol.
Molecular Properties
| Compound Name | CID 46927170 |
| PubChem CID | 46927170 |
| Molecular Formula | C27H26ClN3O |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | — |
| SMILES | CN1OC2(N=C1N)c1cc(-c3cccc(Cl)c3)ccc1CC21CCc2ccccc2CC1 |
| InChI | InChI=1S/C27H26ClN3O/c1-31-25(29)30-27(32-31)24-16-21(20-7-4-8-23(28)15-20)9-10-22(24)17-26(27)13-11-18-5-2-3-6-19(18)12-14-26/h2-10,15-16H,11-14,17H2,1H3,(H2,29,30) |
| InChIKey | FTZGJZCAODWJIN-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 46927170 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 46927170?
The IUPAC name of CID 46927170 (CID 46927170) is not available.
What is the SMILES notation for CID 46927170?
The canonical SMILES for CID 46927170 is CN1OC2(N=C1N)c1cc(-c3cccc(Cl)c3)ccc1CC21CCc2ccccc2CC1.
What is the InChIKey of CID 46927170?
The InChIKey is FTZGJZCAODWJIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26ClN3O/c1-31-25(29)30-27(32-31)24-16-21(20-7-4-8-23(28)15-20)9-10-22(24)17-26(27)13-11-18-5-2-3-6-19(18)12-14-26/h2-10,15-16H,11-14,17H2,1H3,(H2,29,30).
What are the key properties of CID 46927170?
CID 46927170 has a molecular weight of 443.98 g/mol, XLogP of 5.47, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 46927170 is sourced from PubChem (CID 46927170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).