C16H19FN6O3 — CID 4692718
6-(2,6-dimethylmorpholin-4-yl)-2-N-(2-fluorophenyl)-5-nitropyrimidine-2,4-diamine (PubChem CID 4692718) has the molecular formula C16H19FN6O3 and a molecular weight of 362.37 g/mol. Its IUPAC name is 6-(2,6-dimethylmorpholin-4-yl)-2-N-(2-fluorophenyl)-5-nitropyrimidine-2,4-diamine.
| Compound Name | 6-(2,6-dimethylmorpholin-4-yl)-2-N-(2-fluorophenyl)-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 4692718 |
| Molecular Formula | C16H19FN6O3 |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 6-(2,6-dimethylmorpholin-4-yl)-2-N-(2-fluorophenyl)-5-nitropyrimidine-2,4-diamine |
| SMILES | CC1CN(c2nc(Nc3ccccc3F)nc(N)c2[N+](=O)[O-])CC(C)O1 |
| InChI | InChI=1S/C16H19FN6O3/c1-9-7-22(8-10(2)26-9)15-13(23(24)25)14(18)20-16(21-15)19-12-6-4-3-5-11(12)17/h3-6,9-10H,7-8H2,1-2H3,(H3,18,19,20,21) |
| InChIKey | GOKVPBGLAKANAX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|