About N-(6-methoxy-1,3-benzothiazol-2-yl)-2-(4-pyridin-4-ylphenyl)acetamide
N-(6-methoxy-1,3-benzothiazol-2-yl)-2-(4-pyridin-4-ylphenyl)acetamide (PubChem CID 46927440) has the molecular formula C21H17N3O2S
and a molecular weight of 375.45 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-2-(4-pyridin-4-ylphenyl)acetamide.
Molecular Properties
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-2-(4-pyridin-4-ylphenyl)acetamide |
| PubChem CID | 46927440 |
| Molecular Formula | C21H17N3O2S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-2-(4-pyridin-4-ylphenyl)acetamide |
| SMILES | COc1ccc2nc(NC(=O)Cc3ccc(-c4ccncc4)cc3)sc2c1 |
| InChI | InChI=1S/C21H17N3O2S/c1-26-17-6-7-18-19(13-17)27-21(23-18)24-20(25)12-14-2-4-15(5-3-14)16-8-10-22-11-9-16/h2-11,13H,12H2,1H3,(H,23,24,25) |
| InChIKey | IVXHZSZBXWENCY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(6-methoxy-1,3-benzothiazol-2-yl)-2-(4-pyridin-4-ylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-methoxy-1,3-benzothiazol-2-yl)-2-(4-pyridin-4-ylphenyl)acetamide?
The IUPAC name of N-(6-methoxy-1,3-benzothiazol-2-yl)-2-(4-pyridin-4-ylphenyl)acetamide (CID 46927440) is N-(6-methoxy-1,3-benzothiazol-2-yl)-2-(4-pyridin-4-ylphenyl)acetamide.
What is the SMILES notation for N-(6-methoxy-1,3-benzothiazol-2-yl)-2-(4-pyridin-4-ylphenyl)acetamide?
The canonical SMILES for N-(6-methoxy-1,3-benzothiazol-2-yl)-2-(4-pyridin-4-ylphenyl)acetamide is COc1ccc2nc(NC(=O)Cc3ccc(-c4ccncc4)cc3)sc2c1.
What is the InChIKey of N-(6-methoxy-1,3-benzothiazol-2-yl)-2-(4-pyridin-4-ylphenyl)acetamide?
The InChIKey is IVXHZSZBXWENCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N3O2S/c1-26-17-6-7-18-19(13-17)27-21(23-18)24-20(25)12-14-2-4-15(5-3-14)16-8-10-22-11-9-16/h2-11,13H,12H2,1H3,(H,23,24,25).
What are the key properties of N-(6-methoxy-1,3-benzothiazol-2-yl)-2-(4-pyridin-4-ylphenyl)acetamide?
N-(6-methoxy-1,3-benzothiazol-2-yl)-2-(4-pyridin-4-ylphenyl)acetamide has a molecular weight of 375.45 g/mol, XLogP of 4.55, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-methoxy-1,3-benzothiazol-2-yl)-2-(4-pyridin-4-ylphenyl)acetamide is sourced from PubChem (CID 46927440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).