C20H10F2N4O2 — CID 46927868
2-(2,2-difluoro-1,3-benzodioxol-5-yl)-1H-imidazo[4,5-f][1,10]phenanthroline (PubChem CID 46927868) has the molecular formula C20H10F2N4O2 and a molecular weight of 376.32 g/mol. Its IUPAC name is 2-(2,2-difluoro-1,3-benzodioxol-5-yl)-1H-imidazo[4,5-f][1,10]phenanthroline.
| Compound Name | 2-(2,2-difluoro-1,3-benzodioxol-5-yl)-1H-imidazo[4,5-f][1,10]phenanthroline |
|---|---|
| PubChem CID | 46927868 |
| Molecular Formula | C20H10F2N4O2 |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 2-(2,2-difluoro-1,3-benzodioxol-5-yl)-1H-imidazo[4,5-f][1,10]phenanthroline |
| SMILES | FC1(F)Oc2ccc(-c3nc4c5cccnc5c5ncccc5c4[nH]3)cc2O1 |
| InChI | InChI=1S/C20H10F2N4O2/c21-20(22)27-13-6-5-10(9-14(13)28-20)19-25-17-11-3-1-7-23-15(11)16-12(18(17)26-19)4-2-8-24-16/h1-9H,(H,25,26) |
| InChIKey | QHLXNMNBKVEQHJ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|