C19H30O2 — CID 46927917
(2E,6E,10E)-7,11,15-trimethylhexadeca-2,6,10,14-tetraenoic acid (PubChem CID 46927917) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (2E,6E,10E)-7,11,15-trimethylhexadeca-2,6,10,14-tetraenoic acid.
| Compound Name | (2E,6E,10E)-7,11,15-trimethylhexadeca-2,6,10,14-tetraenoic acid |
|---|---|
| PubChem CID | 46927917 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (2E,6E,10E)-7,11,15-trimethylhexadeca-2,6,10,14-tetraenoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C=C/C(=O)O |
| InChI | InChI=1S/C19H30O2/c1-16(2)10-8-12-18(4)14-9-13-17(3)11-6-5-7-15-19(20)21/h7,10-11,14-15H,5-6,8-9,12-13H2,1-4H3,(H,20,21)/b15-7+,17-11+,18-14+ |
| InChIKey | GLPWLKHIIUEHTR-IHKMYNNBSA-N |
| XLogP | 5.83 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|