C22H24ClNO4 — CID 46927984
16,17-dimethoxy-14,14-dimethyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,15(20),16,18-heptaene chloride (PubChem CID 46927984) has the molecular formula C22H24ClNO4 and a molecular weight of 401.89 g/mol. Its IUPAC name is 16,17-dimethoxy-14,14-dimethyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,15(20),16,18-heptaene chloride.
| Compound Name | 16,17-dimethoxy-14,14-dimethyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,15(20),16,18-heptaene chloride |
|---|---|
| PubChem CID | 46927984 |
| Molecular Formula | C22H24ClNO4 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 16,17-dimethoxy-14,14-dimethyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,15(20),16,18-heptaene chloride |
| SMILES | COc1ccc2c(c1OC)C(C)(C)[N+]1=C(C2)c2cc3c(cc2CC1)OCO3.[Cl-] |
| InChI | InChI=1S/C22H24NO4.ClH/c1-22(2)20-14(5-6-17(24-3)21(20)25-4)9-16-15-11-19-18(26-12-27-19)10-13(15)7-8-23(16)22;/h5-6,10-11H,7-9,12H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | MDVUKRMJFRYYIF-UHFFFAOYSA-M |
| XLogP | 0.29 |
| TPSA | 39.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|