C25H28N2O4 — CID 46928068
(1R,8R,9R)-3,4-dihydroxy-12-methoxy-17-methyl-8-(2-methylanilino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one (PubChem CID 46928068) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is (1R,8R,9R)-3,4-dihydroxy-12-methoxy-17-methyl-8-(2-methylanilino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one.
| Compound Name | (1R,8R,9R)-3,4-dihydroxy-12-methoxy-17-methyl-8-(2-methylanilino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one |
|---|---|
| PubChem CID | 46928068 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | (1R,8R,9R)-3,4-dihydroxy-12-methoxy-17-methyl-8-(2-methylanilino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one |
| SMILES | COC1=CC2[C@@H]3[C@H](Nc4ccccc4C)c4ccc(O)c(O)c4[C@]2(CCN3C)CC1=O |
| InChI | InChI=1S/C25H28N2O4/c1-14-6-4-5-7-17(14)26-22-15-8-9-18(28)24(30)21(15)25-10-11-27(2)23(22)16(25)12-20(31-3)19(29)13-25/h4-9,12,16,22-23,26,28,30H,10-11,13H2,1-3H3/t16?,22-,23-,25-/m1/s1 |
| InChIKey | DVQXPCKCIDPTMU-MBNZGBNUSA-N |
| XLogP | 3.63 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|