About diethyl 6-methoxy-3-(4-methoxyphenyl)-4H-quinazoline-2,4-dicarboxylate
diethyl 6-methoxy-3-(4-methoxyphenyl)-4H-quinazoline-2,4-dicarboxylate (PubChem CID 46928184) has the molecular formula C22H24N2O6
and a molecular weight of 412.44 g/mol. Its IUPAC name is diethyl 6-methoxy-3-(4-methoxyphenyl)-4H-quinazoline-2,4-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 6-methoxy-3-(4-methoxyphenyl)-4H-quinazoline-2,4-dicarboxylate |
| PubChem CID | 46928184 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | diethyl 6-methoxy-3-(4-methoxyphenyl)-4H-quinazoline-2,4-dicarboxylate |
| SMILES | CCOC(=O)C1=Nc2ccc(OC)cc2C(C(=O)OCC)N1c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H24N2O6/c1-5-29-21(25)19-17-13-16(28-4)11-12-18(17)23-20(22(26)30-6-2)24(19)14-7-9-15(27-3)10-8-14/h7-13,19H,5-6H2,1-4H3 |
| InChIKey | KJCPWLSKLIQPSR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 86.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze diethyl 6-methoxy-3-(4-methoxyphenyl)-4H-quinazoline-2,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 6-methoxy-3-(4-methoxyphenyl)-4H-quinazoline-2,4-dicarboxylate?
The IUPAC name of diethyl 6-methoxy-3-(4-methoxyphenyl)-4H-quinazoline-2,4-dicarboxylate (CID 46928184) is diethyl 6-methoxy-3-(4-methoxyphenyl)-4H-quinazoline-2,4-dicarboxylate.
What is the SMILES notation for diethyl 6-methoxy-3-(4-methoxyphenyl)-4H-quinazoline-2,4-dicarboxylate?
The canonical SMILES for diethyl 6-methoxy-3-(4-methoxyphenyl)-4H-quinazoline-2,4-dicarboxylate is CCOC(=O)C1=Nc2ccc(OC)cc2C(C(=O)OCC)N1c1ccc(OC)cc1.
What is the InChIKey of diethyl 6-methoxy-3-(4-methoxyphenyl)-4H-quinazoline-2,4-dicarboxylate?
The InChIKey is KJCPWLSKLIQPSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O6/c1-5-29-21(25)19-17-13-16(28-4)11-12-18(17)23-20(22(26)30-6-2)24(19)14-7-9-15(27-3)10-8-14/h7-13,19H,5-6H2,1-4H3.
What are the key properties of diethyl 6-methoxy-3-(4-methoxyphenyl)-4H-quinazoline-2,4-dicarboxylate?
diethyl 6-methoxy-3-(4-methoxyphenyl)-4H-quinazoline-2,4-dicarboxylate has a molecular weight of 412.44 g/mol, XLogP of 3.42, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 6-methoxy-3-(4-methoxyphenyl)-4H-quinazoline-2,4-dicarboxylate is sourced from PubChem (CID 46928184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).